C33H34F4O2S — CID 123416898
17-hydroxy-13-methyl-11-[4-(4-sulfanylphenyl)phenyl]-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 123416898) has the molecular formula C33H34F4O2S and a molecular weight of 570.69 g/mol. Its IUPAC name is 17-hydroxy-13-methyl-11-[4-(4-sulfanylphenyl)phenyl]-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-hydroxy-13-methyl-11-[4-(4-sulfanylphenyl)phenyl]-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123416898 |
| Molecular Formula | C33H34F4O2S |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 17-hydroxy-13-methyl-11-[4-(4-sulfanylphenyl)phenyl]-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(F)(F)C(F)(F)C1(O)CCC2C3CCC4=CC(=O)CCC4=C3C(c3ccc(-c4ccc(S)cc4)cc3)CC21C |
| InChI | InChI=1S/C33H34F4O2S/c1-30-18-27(21-5-3-19(4-6-21)20-7-11-24(40)12-8-20)29-25-14-10-23(38)17-22(25)9-13-26(29)28(30)15-16-32(30,39)33(36,37)31(2,34)35/h3-8,11-12,17,26-28,39-40H,9-10,13-16,18H2,1-2H3 |
| InChIKey | UQWRFPQPLIXEDL-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|