C28H32F4O — CID 89027216
13-methyl-3-methylidene-11-phenyl-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 89027216) has the molecular formula C28H32F4O and a molecular weight of 460.56 g/mol. Its IUPAC name is 13-methyl-3-methylidene-11-phenyl-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | 13-methyl-3-methylidene-11-phenyl-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 89027216 |
| Molecular Formula | C28H32F4O |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 13-methyl-3-methylidene-11-phenyl-17-(1,1,2,2-tetrafluoropropyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C=C1C=C2CCC3C(=C2CC1)C(c1ccccc1)CC1(C)C3CCC1(O)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C28H32F4O/c1-17-9-11-20-19(15-17)10-12-21-23-13-14-27(33,28(31,32)26(3,29)30)25(23,2)16-22(24(20)21)18-7-5-4-6-8-18/h4-8,15,21-23,33H,1,9-14,16H2,2-3H3 |
| InChIKey | ZKILMKNMYZETRY-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|