C35H38F4S — CID 130350051
4-[4-[(17R)-13,17-dimethyl-3-methylidene-17-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]benzenethiol (PubChem CID 130350051) has the molecular formula C35H38F4S and a molecular weight of 566.75 g/mol. Its IUPAC name is 4-[4-[(17R)-13,17-dimethyl-3-methylidene-17-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]benzenethiol.
| Compound Name | 4-[4-[(17R)-13,17-dimethyl-3-methylidene-17-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]benzenethiol |
|---|---|
| PubChem CID | 130350051 |
| Molecular Formula | C35H38F4S |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 4-[4-[(17R)-13,17-dimethyl-3-methylidene-17-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]benzenethiol |
| SMILES | C=C1C=C2CCC3C(=C2CC1)C(c1ccc(-c2ccc(S)cc2)cc1)CC1(C)C3CC[C@@]1(C)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C35H38F4S/c1-21-5-15-27-25(19-21)12-16-28-30-17-18-33(3,34(4,36)35(37,38)39)32(30,2)20-29(31(27)28)24-8-6-22(7-9-24)23-10-13-26(40)14-11-23/h6-11,13-14,19,28-30,40H,1,5,12,15-18,20H2,2-4H3/t28?,29?,30?,32?,33-,34?/m1/s1 |
| InChIKey | VZXDPTHVUWLANR-MFTOPAPPSA-N |
| XLogP | 10.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|