C30H31F3O2 — CID 144519419
1-[4-[17-hydroxy-13-methyl-3-methylidene-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethanone (PubChem CID 144519419) has the molecular formula C30H31F3O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 1-[4-[17-hydroxy-13-methyl-3-methylidene-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethanone.
| Compound Name | 1-[4-[17-hydroxy-13-methyl-3-methylidene-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 144519419 |
| Molecular Formula | C30H31F3O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 1-[4-[17-hydroxy-13-methyl-3-methylidene-17-(3,3,3-trifluoroprop-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethanone |
| SMILES | C=C1C=C2CCC3C(=C2CC1)C(c1ccc(C(C)=O)cc1)CC1(C)C3CCC1(O)C#CC(F)(F)F |
| InChI | InChI=1S/C30H31F3O2/c1-18-4-10-23-22(16-18)9-11-24-26-12-13-29(35,14-15-30(31,32)33)28(26,3)17-25(27(23)24)21-7-5-20(6-8-21)19(2)34/h5-8,16,24-26,35H,1,4,9-13,17H2,2-3H3 |
| InChIKey | XCNJTDDUMRSUSZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|