C32H33F2NO2 — CID 89395985
(8S,11R,13S,14S,17S)-17-(1,1-difluoroprop-2-enyl)-17-hydroxy-13-methyl-11-(4-pyridin-3-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 89395985) has the molecular formula C32H33F2NO2 and a molecular weight of 501.62 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-(1,1-difluoroprop-2-enyl)-17-hydroxy-13-methyl-11-(4-pyridin-3-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-(1,1-difluoroprop-2-enyl)-17-hydroxy-13-methyl-11-(4-pyridin-3-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 89395985 |
| Molecular Formula | C32H33F2NO2 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-(1,1-difluoroprop-2-enyl)-17-hydroxy-13-methyl-11-(4-pyridin-3-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=CC(F)(F)[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(-c4cccnc4)cc3)C[C@@]21C |
| InChI | InChI=1S/C32H33F2NO2/c1-3-32(33,34)31(37)15-14-28-26-12-10-22-17-24(36)11-13-25(22)29(26)27(18-30(28,31)2)21-8-6-20(7-9-21)23-5-4-16-35-19-23/h3-9,16-17,19,26-28,37H,1,10-15,18H2,2H3/t26-,27+,28-,30-,31-/m0/s1 |
| InChIKey | SAWUFTPJGOPRDB-PABOLRIOSA-N |
| XLogP | 7.20 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|