C31H37F5N2O2 — CID 88915446
(17S)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-(piperazin-1-ylmethyl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88915446) has the molecular formula C31H37F5N2O2 and a molecular weight of 564.64 g/mol. Its IUPAC name is (17S)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-(piperazin-1-ylmethyl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (17S)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-(piperazin-1-ylmethyl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88915446 |
| Molecular Formula | C31H37F5N2O2 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | (17S)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-(piperazin-1-ylmethyl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC(c3ccc(CN4CCNCC4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H37F5N2O2/c1-28-17-25(20-4-2-19(3-5-20)18-38-14-12-37-13-15-38)27-23-9-7-22(39)16-21(23)6-8-24(27)26(28)10-11-29(28,40)30(32,33)31(34,35)36/h2-5,16,24-26,37,40H,6-15,17-18H2,1H3/t24?,25?,26?,28?,29-/m0/s1 |
| InChIKey | FKKXYBBJZSTCSO-OZPDYWEWSA-N |
| XLogP | 5.92 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|