C32H36F5NO3 — CID 89438216
(8S,11R,13S,14S,17R)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-(piperidine-1-carbonyl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 89438216) has the molecular formula C32H36F5NO3 and a molecular weight of 577.63 g/mol. Its IUPAC name is (8S,11R,13S,14S,17R)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-(piperidine-1-carbonyl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17R)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-(piperidine-1-carbonyl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 89438216 |
| Molecular Formula | C32H36F5NO3 |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | (8S,11R,13S,14S,17R)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-11-[4-(piperidine-1-carbonyl)phenyl]-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(C(=O)N4CCCCC4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H36F5NO3/c1-29-18-25(19-5-7-20(8-6-19)28(40)38-15-3-2-4-16-38)27-23-12-10-22(39)17-21(23)9-11-24(27)26(29)13-14-30(29,41)31(33,34)32(35,36)37/h5-8,17,24-26,41H,2-4,9-16,18H2,1H3/t24-,25+,26-,29-,30+/m0/s1 |
| InChIKey | JGLHMUYJBHROEK-HMWAHOBHSA-N |
| XLogP | 7.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|