C31H34F5NO4 — CID 53345598
(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(morpholine-4-carbonyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 53345598) has the molecular formula C31H34F5NO4 and a molecular weight of 579.61 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(morpholine-4-carbonyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(morpholine-4-carbonyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 53345598 |
| Molecular Formula | C31H34F5NO4 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-[4-(morpholine-4-carbonyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(C(=O)N4CCOCC4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H34F5NO4/c1-28-17-24(18-2-4-19(5-3-18)27(39)37-12-14-41-15-13-37)26-22-9-7-21(38)16-20(22)6-8-23(26)25(28)10-11-29(28,40)30(32,33)31(34,35)36/h2-5,16,23-25,40H,6-15,17H2,1H3/t23-,24+,25-,28-,29-/m0/s1 |
| InChIKey | LUWKQKUBLHRKAA-DQFOBABISA-N |
| XLogP | 5.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|