C34H41F5N2O3 — CID 88915585
(11R,17S)-11-[4-[(4-acetyl-1,4-diazepan-1-yl)methyl]phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88915585) has the molecular formula C34H41F5N2O3 and a molecular weight of 620.70 g/mol. Its IUPAC name is (11R,17S)-11-[4-[(4-acetyl-1,4-diazepan-1-yl)methyl]phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,17S)-11-[4-[(4-acetyl-1,4-diazepan-1-yl)methyl]phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88915585 |
| Molecular Formula | C34H41F5N2O3 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | (11R,17S)-11-[4-[(4-acetyl-1,4-diazepan-1-yl)methyl]phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)N1CCCN(Cc2ccc([C@H]3CC4(C)C(CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)cc2)CC1 |
| InChI | InChI=1S/C34H41F5N2O3/c1-21(42)41-15-3-14-40(16-17-41)20-22-4-6-23(7-5-22)28-19-31(2)29(12-13-32(31,44)33(35,36)34(37,38)39)27-10-8-24-18-25(43)9-11-26(24)30(27)28/h4-7,18,27-29,44H,3,8-17,19-20H2,1-2H3/t27?,28-,29?,31?,32+/m1/s1 |
| InChIKey | VPHXDBGCXFOZCX-HBDOPOBHSA-N |
| XLogP | 6.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|