C26H27F5NO3S- — CID 153284949
CID 153284949 (PubChem CID 153284949) has the molecular formula C26H27F5NO3S- and a molecular weight of 528.56 g/mol.
| Compound Name | CID 153284949 |
|---|---|
| PubChem CID | 153284949 |
| Molecular Formula | C26H27F5NO3S- |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | — |
| SMILES | [H]/N=[S-](=O)/c1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]3(O)C(F)(F)C(F)(F)F)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C26H27F5NO3S/c1-23-13-20(14-2-6-17(7-3-14)36(32)35)22-18-9-5-16(33)12-15(18)4-8-19(22)21(23)10-11-24(23,34)25(27,28)26(29,30)31/h2-3,6-7,12,19-21,32,34H,4-5,8-11,13H2,1H3/q-1/t19-,20+,21-,23-,24-/m0/s1 |
| InChIKey | VZYPJDPGWXIRHZ-DTVVZGISSA-N |
| XLogP | 6.60 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|