C34H32F5NO5 — CID 88918083
3-[[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]amino]benzoic acid (PubChem CID 88918083) has the molecular formula C34H32F5NO5 and a molecular weight of 629.62 g/mol. Its IUPAC name is 3-[[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]amino]benzoic acid.
| Compound Name | 3-[[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 88918083 |
| Molecular Formula | C34H32F5NO5 |
| Molecular Weight | 629.62 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | 3-[[4-[(11R,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]benzoyl]amino]benzoic acid |
| SMILES | CC12C[C@H](c3ccc(C(=O)Nc4cccc(C(=O)O)c4)cc3)C3=C4CCC(=O)C=C4CCC3[C@@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H32F5NO5/c1-31-17-26(18-5-7-19(8-6-18)29(42)40-22-4-2-3-21(15-22)30(43)44)28-24-12-10-23(41)16-20(24)9-11-25(28)27(31)13-14-32(31,45)33(35,36)34(37,38)39/h2-8,15-16,25-27,45H,9-14,17H2,1H3,(H,40,42)(H,43,44)/t25?,26-,27+,31?,32+/m1/s1 |
| InChIKey | YYTRGCLWORYRTJ-NBVUVZKPSA-N |
| XLogP | 7.47 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.62 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|