C30H37F3O2S — CID 123854993
11-(4-ethylsulfanylphenyl)-17-hydroxy-13-methyl-17-(2,3,3-trifluorobutan-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 123854993) has the molecular formula C30H37F3O2S and a molecular weight of 518.69 g/mol. Its IUPAC name is 11-(4-ethylsulfanylphenyl)-17-hydroxy-13-methyl-17-(2,3,3-trifluorobutan-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 11-(4-ethylsulfanylphenyl)-17-hydroxy-13-methyl-17-(2,3,3-trifluorobutan-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123854993 |
| Molecular Formula | C30H37F3O2S |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 11-(4-ethylsulfanylphenyl)-17-hydroxy-13-methyl-17-(2,3,3-trifluorobutan-2-yl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCSc1ccc(C2CC3(C)C(CCC3(O)C(C)(F)C(C)(F)F)C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C30H37F3O2S/c1-5-36-21-10-6-18(7-11-21)24-17-27(2)25(14-15-30(27,35)28(3,31)29(4,32)33)23-12-8-19-16-20(34)9-13-22(19)26(23)24/h6-7,10-11,16,23-25,35H,5,8-9,12-15,17H2,1-4H3 |
| InChIKey | VQVNDTOIPXYDPI-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |