C27H27F2O2Re- — CID 149077761
(11R,13S,17S)-17-(1,1-difluoroprop-2-ynyl)-17-hydroxy-13-methyl-11-phenyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one;rhenium (PubChem CID 149077761) has the molecular formula C27H27F2O2Re- and a molecular weight of 607.71 g/mol. Its IUPAC name is (11R,13S,17S)-17-(1,1-difluoroprop-2-ynyl)-17-hydroxy-13-methyl-11-phenyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one;rhenium.
| Compound Name | (11R,13S,17S)-17-(1,1-difluoroprop-2-ynyl)-17-hydroxy-13-methyl-11-phenyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one;rhenium |
|---|---|
| PubChem CID | 149077761 |
| Molecular Formula | C27H27F2O2Re- |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | (11R,13S,17S)-17-(1,1-difluoroprop-2-ynyl)-17-hydroxy-13-methyl-11-phenyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one;rhenium |
| SMILES | C#CC(F)(F)[C@]1(O)CCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3cc[c-]cc3)C[C@@]21C.[Re] |
| InChI | InChI=1S/C27H27F2O2.Re/c1-3-27(28,29)26(31)14-13-23-21-11-9-18-15-19(30)10-12-20(18)24(21)22(16-25(23,26)2)17-7-5-4-6-8-17;/h1,5-8,15,21-23,31H,9-14,16H2,2H3;/q-1;/t21?,22-,23?,25+,26+;/m1./s1 |
| InChIKey | MHHVTJOPHNSQLQ-BWEJOSBUSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|