C31H38F2O — CID 122577637
(13S,17S)-11-(4-tert-butylphenyl)-17-(1,1-difluoroprop-2-ynyl)-13-methyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 122577637) has the molecular formula C31H38F2O and a molecular weight of 464.64 g/mol. Its IUPAC name is (13S,17S)-11-(4-tert-butylphenyl)-17-(1,1-difluoroprop-2-ynyl)-13-methyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (13S,17S)-11-(4-tert-butylphenyl)-17-(1,1-difluoroprop-2-ynyl)-13-methyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 122577637 |
| Molecular Formula | C31H38F2O |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | (13S,17S)-11-(4-tert-butylphenyl)-17-(1,1-difluoroprop-2-ynyl)-13-methyl-2,3,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C#CC(F)(F)[C@]1(O)CCC2C3CCC4=CCCCC4=C3C(c3ccc(C(C)(C)C)cc3)C[C@@]21C |
| InChI | InChI=1S/C31H38F2O/c1-6-31(32,33)30(34)18-17-26-24-16-13-20-9-7-8-10-23(20)27(24)25(19-29(26,30)5)21-11-14-22(15-12-21)28(2,3)4/h1,9,11-12,14-15,24-26,34H,7-8,10,13,16-19H2,2-5H3/t24?,25?,26?,29-,30-/m0/s1 |
| InChIKey | LQAGCSGMMPPOAG-VABNTSDVSA-N |
| XLogP | 7.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|