C33H35Cl2NO3 — CID 118312039
(11R,13S)-11-[4-[(E)-(3,4-dichlorophenyl)methoxyiminomethyl]phenyl]-17-hydroxy-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 118312039) has the molecular formula C33H35Cl2NO3 and a molecular weight of 564.55 g/mol. Its IUPAC name is (11R,13S)-11-[4-[(E)-(3,4-dichlorophenyl)methoxyiminomethyl]phenyl]-17-hydroxy-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S)-11-[4-[(E)-(3,4-dichlorophenyl)methoxyiminomethyl]phenyl]-17-hydroxy-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 118312039 |
| Molecular Formula | C33H35Cl2NO3 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | (11R,13S)-11-[4-[(E)-(3,4-dichlorophenyl)methoxyiminomethyl]phenyl]-17-hydroxy-13,17-dimethyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1(O)CCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(/C=N/OCc4ccc(Cl)c(Cl)c4)cc3)C[C@@]21C |
| InChI | InChI=1S/C33H35Cl2NO3/c1-32-17-27(22-6-3-20(4-7-22)18-36-39-19-21-5-12-29(34)30(35)15-21)31-25-11-9-24(37)16-23(25)8-10-26(31)28(32)13-14-33(32,2)38/h3-7,12,15-16,18,26-28,38H,8-11,13-14,17,19H2,1-2H3/b36-18+/t26?,27-,28?,32+,33?/m1/s1 |
| InChIKey | XFEPOUFODBRJDV-VUMIMUKISA-N |
| XLogP | 8.19 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|