C35H39NO6 — CID 10166796
[(E)-[4-[(11R,13S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino] phenyl carbonate (PubChem CID 10166796) has the molecular formula C35H39NO6 and a molecular weight of 569.70 g/mol. Its IUPAC name is [(E)-[4-[(11R,13S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino] phenyl carbonate.
| Compound Name | [(E)-[4-[(11R,13S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino] phenyl carbonate |
|---|---|
| PubChem CID | 10166796 |
| Molecular Formula | C35H39NO6 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | [(E)-[4-[(11R,13S,17S)-17-methoxy-17-(methoxymethyl)-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylideneamino] phenyl carbonate |
| SMILES | COC[C@]1(OC)CCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(/C=N/OC(=O)Oc4ccccc4)cc3)C[C@@]21C |
| InChI | InChI=1S/C35H39NO6/c1-34-20-30(24-11-9-23(10-12-24)21-36-42-33(38)41-27-7-5-4-6-8-27)32-28-16-14-26(37)19-25(28)13-15-29(32)31(34)17-18-35(34,40-3)22-39-2/h4-12,19,21,29-31H,13-18,20,22H2,1-3H3/b36-21+/t29?,30-,31?,34+,35-/m1/s1 |
| InChIKey | IAUTVVYDBRYXSY-TWALYSNKSA-N |
| XLogP | 7.17 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|