C31H39NO6 — CID 16750509
[(E)-[4-[(5R,6aS,7S)-7-methoxy-7-(methoxymethyl)-6a-methyl-2-oxo-4,5,6,8,9,10,10a,10b,11,12-decahydro-3H-chrysen-5-yl]phenyl]methylideneamino] methyl carbonate (PubChem CID 16750509) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is [(E)-[4-[(5R,6aS,7S)-7-methoxy-7-(methoxymethyl)-6a-methyl-2-oxo-4,5,6,8,9,10,10a,10b,11,12-decahydro-3H-chrysen-5-yl]phenyl]methylideneamino] methyl carbonate.
| Compound Name | [(E)-[4-[(5R,6aS,7S)-7-methoxy-7-(methoxymethyl)-6a-methyl-2-oxo-4,5,6,8,9,10,10a,10b,11,12-decahydro-3H-chrysen-5-yl]phenyl]methylideneamino] methyl carbonate |
|---|---|
| PubChem CID | 16750509 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | [(E)-[4-[(5R,6aS,7S)-7-methoxy-7-(methoxymethyl)-6a-methyl-2-oxo-4,5,6,8,9,10,10a,10b,11,12-decahydro-3H-chrysen-5-yl]phenyl]methylideneamino] methyl carbonate |
| SMILES | COC[C@]1(OC)CCCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(/C=N/OC(=O)OC)cc3)C[C@@]21C |
| InChI | InChI=1S/C31H39NO6/c1-30-17-26(21-9-7-20(8-10-21)18-32-38-29(34)36-3)28-24-14-12-23(33)16-22(24)11-13-25(28)27(30)6-5-15-31(30,37-4)19-35-2/h7-10,16,18,25-27H,5-6,11-15,17,19H2,1-4H3/b32-18+/t25?,26-,27?,30+,31-/m1/s1 |
| InChIKey | KFFJUVVMYFHKEJ-AJTBOJOFSA-N |
| XLogP | 6.12 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|