C29H35NO3S — CID 18714914
[(E)-[4-(13,17,17-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl)phenyl]methylideneamino] methylsulfanylformate (PubChem CID 18714914) has the molecular formula C29H35NO3S and a molecular weight of 477.67 g/mol. Its IUPAC name is [(E)-[4-(13,17,17-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl)phenyl]methylideneamino] methylsulfanylformate.
| Compound Name | [(E)-[4-(13,17,17-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl)phenyl]methylideneamino] methylsulfanylformate |
|---|---|
| PubChem CID | 18714914 |
| Molecular Formula | C29H35NO3S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | [(E)-[4-(13,17,17-trimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl)phenyl]methylideneamino] methylsulfanylformate |
| SMILES | CSC(=O)O/N=C/c1ccc(C2CC3(C)C(CCC3(C)C)C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C29H35NO3S/c1-28(2)14-13-25-23-11-9-20-15-21(31)10-12-22(20)26(23)24(16-29(25,28)3)19-7-5-18(6-8-19)17-30-33-27(32)34-4/h5-8,15,17,23-25H,9-14,16H2,1-4H3/b30-17+ |
| InChIKey | NOGIZPRINWBLMR-OCSSWDANSA-N |
| XLogP | 7.45 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|