C32H40N2O3 — CID 163507149
1-[(E)-3-[4-[(11R,13S,17S)-17-hydroxy-13,17-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]prop-2-enyl]-3-prop-2-enylurea (PubChem CID 163507149) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is 1-[(E)-3-[4-[(11R,13S,17S)-17-hydroxy-13,17-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]prop-2-enyl]-3-prop-2-enylurea.
| Compound Name | 1-[(E)-3-[4-[(11R,13S,17S)-17-hydroxy-13,17-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]prop-2-enyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 163507149 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 1-[(E)-3-[4-[(11R,13S,17S)-17-hydroxy-13,17-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]prop-2-enyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NC/C=C/c1ccc([C@H]2C[C@@]3(C)C(CC[C@]3(C)O)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C32H40N2O3/c1-4-17-33-30(36)34-18-5-6-21-7-9-22(10-8-21)27-20-31(2)28(15-16-32(31,3)37)26-13-11-23-19-24(35)12-14-25(23)29(26)27/h4-10,19,26-28,37H,1,11-18,20H2,2-3H3,(H2,33,34,36)/b6-5+/t26?,27-,28?,31+,32+/m1/s1 |
| InChIKey | CZMRYWOKDQDELR-IUAFTXGTSA-N |
| XLogP | 5.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|