C34H39NO2 — CID 145342668
11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylbenzene (PubChem CID 145342668) has the molecular formula C34H39NO2 and a molecular weight of 493.69 g/mol. Its IUPAC name is 11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylbenzene.
| Compound Name | 11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylbenzene |
|---|---|
| PubChem CID | 145342668 |
| Molecular Formula | C34H39NO2 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 11-[4-(dimethylamino)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethynylbenzene |
| SMILES | C#Cc1ccccc1.CN(C)c1ccc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C26H33NO2.C8H6/c1-26-15-22(16-4-7-18(8-5-16)27(2)3)25-20-11-9-19(28)14-17(20)6-10-21(25)23(26)12-13-24(26)29;1-2-8-6-4-3-5-7-8/h4-5,7-8,14,21-24,29H,6,9-13,15H2,1-3H3;1,3-7H |
| InChIKey | ZHUFPHSJSQIGID-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|