C26H31ClO2 — CID 91564183
(8S,13S,14S)-11-[4-(2-chloroethyl)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 91564183) has the molecular formula C26H31ClO2 and a molecular weight of 410.99 g/mol. Its IUPAC name is (8S,13S,14S)-11-[4-(2-chloroethyl)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S)-11-[4-(2-chloroethyl)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91564183 |
| Molecular Formula | C26H31ClO2 |
| Molecular Weight | 410.99 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (8S,13S,14S)-11-[4-(2-chloroethyl)phenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC(c3ccc(CCCl)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CCC2O |
| InChI | InChI=1S/C26H31ClO2/c1-26-15-22(17-4-2-16(3-5-17)12-13-27)25-20-9-7-19(28)14-18(20)6-8-21(25)23(26)10-11-24(26)29/h2-5,14,21-24,29H,6-13,15H2,1H3/t21-,22?,23-,24?,26-/m0/s1 |
| InChIKey | BPYREFNUAHOCFP-CBPWRVFUSA-N |
| XLogP | 5.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.99 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|