C28H34O3 — CID 142845235
17-hydroxy-13-methyl-11-(3-methyl-4-prop-2-enoxyphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 142845235) has the molecular formula C28H34O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is 17-hydroxy-13-methyl-11-(3-methyl-4-prop-2-enoxyphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-hydroxy-13-methyl-11-(3-methyl-4-prop-2-enoxyphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142845235 |
| Molecular Formula | C28H34O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 17-hydroxy-13-methyl-11-(3-methyl-4-prop-2-enoxyphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=CCOc1ccc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)cc1C |
| InChI | InChI=1S/C28H34O3/c1-4-13-31-25-11-6-18(14-17(25)2)23-16-28(3)24(10-12-26(28)30)22-8-5-19-15-20(29)7-9-21(19)27(22)23/h4,6,11,14-15,22-24,26,30H,1,5,7-10,12-13,16H2,2-3H3 |
| InChIKey | VTSMWYIUUULWQM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|