C26H32O3 — CID 145342784
17-hydroxy-11-[3-(1-hydroxyethyl)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 145342784) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is 17-hydroxy-11-[3-(1-hydroxyethyl)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 17-hydroxy-11-[3-(1-hydroxyethyl)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 145342784 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 17-hydroxy-11-[3-(1-hydroxyethyl)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(O)c1cccc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)c1 |
| InChI | InChI=1S/C26H32O3/c1-15(27)16-4-3-5-17(12-16)22-14-26(2)23(10-11-24(26)29)21-8-6-18-13-19(28)7-9-20(18)25(21)22/h3-5,12-13,15,21-24,27,29H,6-11,14H2,1-2H3 |
| InChIKey | SNOHSAOJSYADRO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |