C30H38FNO2 — CID 145342789
11-[4-(dimethylamino)-3-fluoro-5-methylphenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne (PubChem CID 145342789) has the molecular formula C30H38FNO2 and a molecular weight of 463.64 g/mol. Its IUPAC name is 11-[4-(dimethylamino)-3-fluoro-5-methylphenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne.
| Compound Name | 11-[4-(dimethylamino)-3-fluoro-5-methylphenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne |
|---|---|
| PubChem CID | 145342789 |
| Molecular Formula | C30H38FNO2 |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 11-[4-(dimethylamino)-3-fluoro-5-methylphenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;prop-1-yne |
| SMILES | C#CC.Cc1cc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)cc(F)c1N(C)C |
| InChI | InChI=1S/C27H34FNO2.C3H4/c1-15-11-17(13-23(28)26(15)29(3)4)21-14-27(2)22(9-10-24(27)31)20-7-5-16-12-18(30)6-8-19(16)25(20)21;1-3-2/h11-13,20-22,24,31H,5-10,14H2,1-4H3;1H,2H3 |
| InChIKey | LLJNPEPAGIJNIQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|