C32H41F2NO2 — CID 145342557
11-[4-(dimethylamino)-3,5-difluorophenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne (PubChem CID 145342557) has the molecular formula C32H41F2NO2 and a molecular weight of 509.68 g/mol. Its IUPAC name is 11-[4-(dimethylamino)-3,5-difluorophenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne.
| Compound Name | 11-[4-(dimethylamino)-3,5-difluorophenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne |
|---|---|
| PubChem CID | 145342557 |
| Molecular Formula | C32H41F2NO2 |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | 11-[4-(dimethylamino)-3,5-difluorophenyl]-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne |
| SMILES | C#CC(C)(C)C.CN(C)c1c(F)cc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)cc1F |
| InChI | InChI=1S/C26H31F2NO2.C6H10/c1-26-13-19(15-11-21(27)25(29(2)3)22(28)12-15)24-17-7-5-16(30)10-14(17)4-6-18(24)20(26)8-9-23(26)31;1-5-6(2,3)4/h10-12,18-20,23,31H,4-9,13H2,1-3H3;1H,2-4H3 |
| InChIKey | VLZVFZPYUFVCKO-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|