C30H36F2O2 — CID 145342572
11-(2,5-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne (PubChem CID 145342572) has the molecular formula C30H36F2O2 and a molecular weight of 466.61 g/mol. Its IUPAC name is 11-(2,5-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne.
| Compound Name | 11-(2,5-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne |
|---|---|
| PubChem CID | 145342572 |
| Molecular Formula | C30H36F2O2 |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 11-(2,5-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3,3-dimethylbut-1-yne |
| SMILES | C#CC(C)(C)C.CC12CC(c3cc(F)ccc3F)C3=C4CCC(=O)C=C4CCC3C1CCC2O |
| InChI | InChI=1S/C24H26F2O2.C6H10/c1-24-12-19(18-11-14(25)3-8-21(18)26)23-16-6-4-15(27)10-13(16)2-5-17(23)20(24)7-9-22(24)28;1-5-6(2,3)4/h3,8,10-11,17,19-20,22,28H,2,4-7,9,12H2,1H3;1H,2-4H3 |
| InChIKey | VFHDVGYIVUKKGM-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|