C31H38F2O2 — CID 145342665
11-(4-ethyl-2,6-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3-methylbut-1-yne (PubChem CID 145342665) has the molecular formula C31H38F2O2 and a molecular weight of 480.64 g/mol. Its IUPAC name is 11-(4-ethyl-2,6-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3-methylbut-1-yne.
| Compound Name | 11-(4-ethyl-2,6-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3-methylbut-1-yne |
|---|---|
| PubChem CID | 145342665 |
| Molecular Formula | C31H38F2O2 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 11-(4-ethyl-2,6-difluorophenyl)-17-hydroxy-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;3-methylbut-1-yne |
| SMILES | C#CC(C)C.CCc1cc(F)c(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)c(F)c1 |
| InChI | InChI=1S/C26H30F2O2.C5H8/c1-3-14-10-21(27)25(22(28)11-14)19-13-26(2)20(8-9-23(26)30)18-6-4-15-12-16(29)5-7-17(15)24(18)19;1-4-5(2)3/h10-12,18-20,23,30H,3-9,13H2,1-2H3;1,5H,2-3H3 |
| InChIKey | NNOHJBAGACXAAC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|