C31H39F3O4 — CID 164603892
3,3-difluoroprop-1-yne;fluoromethane;17-hydroxy-11-[2-(2-methoxyethoxy)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 164603892) has the molecular formula C31H39F3O4 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3,3-difluoroprop-1-yne;fluoromethane;17-hydroxy-11-[2-(2-methoxyethoxy)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 3,3-difluoroprop-1-yne;fluoromethane;17-hydroxy-11-[2-(2-methoxyethoxy)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 164603892 |
| Molecular Formula | C31H39F3O4 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 3,3-difluoroprop-1-yne;fluoromethane;17-hydroxy-11-[2-(2-methoxyethoxy)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C#CC(F)F.CF.COCCOc1ccccc1C1CC2(C)C(O)CCC2C2CCC3=CC(=O)CCC3=C12 |
| InChI | InChI=1S/C27H34O4.C3H2F2.CH3F/c1-27-16-22(20-5-3-4-6-24(20)31-14-13-30-2)26-19-10-8-18(28)15-17(19)7-9-21(26)23(27)11-12-25(27)29;1-2-3(4)5;1-2/h3-6,15,21-23,25,29H,7-14,16H2,1-2H3;1,3H;1H3 |
| InChIKey | BESYAEOJIDVZCT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|