C33H35NO5 — CID 123668371
methyl 2-[[4-(17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)benzoyl]amino]benzoate (PubChem CID 123668371) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is methyl 2-[[4-(17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)benzoyl]amino]benzoate.
| Compound Name | methyl 2-[[4-(17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 123668371 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | methyl 2-[[4-(17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc(C2CC3(C)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C33H35NO5/c1-33-18-26(30-23-14-12-22(35)17-21(23)11-13-24(30)27(33)15-16-29(33)36)19-7-9-20(10-8-19)31(37)34-28-6-4-3-5-25(28)32(38)39-2/h3-10,17,24,26-27,29,36H,11-16,18H2,1-2H3,(H,34,37) |
| InChIKey | PZHZTJGPZBKHTP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |