C32H38O3 — CID 145095732
17-acetyl-11-[4-(furan-3-yl)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane (PubChem CID 145095732) has the molecular formula C32H38O3 and a molecular weight of 470.65 g/mol. Its IUPAC name is 17-acetyl-11-[4-(furan-3-yl)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane.
| Compound Name | 17-acetyl-11-[4-(furan-3-yl)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane |
|---|---|
| PubChem CID | 145095732 |
| Molecular Formula | C32H38O3 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 17-acetyl-11-[4-(furan-3-yl)phenyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane |
| SMILES | CC.CC(=O)C1CCC2C3CCC4=CC(=O)CCC4=C3C(c3ccc(-c4ccoc4)cc3)CC12C |
| InChI | InChI=1S/C30H32O3.C2H6/c1-18(31)27-11-12-28-25-9-7-21-15-23(32)8-10-24(21)29(25)26(16-30(27,28)2)20-5-3-19(4-6-20)22-13-14-33-17-22;1-2/h3-6,13-15,17,25-28H,7-12,16H2,1-2H3;1-2H3 |
| InChIKey | ZMCZWNYIAAZZSG-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |