C32H36O5 — CID 91231226
(8S,11R,13S,14S,17S)-11-(4-acetylphenyl)-17-[2-(4-hydroxybut-2-ynoxy)acetyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 91231226) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(4-acetylphenyl)-17-[2-(4-hydroxybut-2-ynoxy)acetyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(4-acetylphenyl)-17-[2-(4-hydroxybut-2-ynoxy)acetyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91231226 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(4-acetylphenyl)-17-[2-(4-hydroxybut-2-ynoxy)acetyl]-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)c1ccc([C@H]2C[C@]3(C)[C@@H](C(=O)COCC#CCO)CC[C@H]3[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C32H36O5/c1-20(34)21-5-7-22(8-6-21)27-18-32(2)28(13-14-29(32)30(36)19-37-16-4-3-15-33)26-11-9-23-17-24(35)10-12-25(23)31(26)27/h5-8,17,26-29,33H,9-16,18-19H2,1-2H3/t26-,27+,28-,29+,32-/m0/s1 |
| InChIKey | GEAMCQBKIUOMIC-WRZYSUBXSA-N |
| XLogP | 4.99 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|