C35H44N2O3 — CID 91391448
2-but-2-ynoxy-1-[(8S,11R,13S,14S,17S)-13-methyl-3-nitroso-11-(4-piperidin-1-ylphenyl)-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 91391448) has the molecular formula C35H44N2O3 and a molecular weight of 540.75 g/mol. Its IUPAC name is 2-but-2-ynoxy-1-[(8S,11R,13S,14S,17S)-13-methyl-3-nitroso-11-(4-piperidin-1-ylphenyl)-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-but-2-ynoxy-1-[(8S,11R,13S,14S,17S)-13-methyl-3-nitroso-11-(4-piperidin-1-ylphenyl)-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 91391448 |
| Molecular Formula | C35H44N2O3 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 540.34 |
| IUPAC Name | 2-but-2-ynoxy-1-[(8S,11R,13S,14S,17S)-13-methyl-3-nitroso-11-(4-piperidin-1-ylphenyl)-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC#CCOCC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(N=O)CCC4=C3[C@@H](c3ccc(N4CCCCC4)cc3)C[C@]12C |
| InChI | InChI=1S/C35H44N2O3/c1-3-4-20-40-23-33(38)32-17-16-31-29-14-10-25-21-26(36-39)11-15-28(25)34(29)30(22-35(31,32)2)24-8-12-27(13-9-24)37-18-6-5-7-19-37/h8-9,12-13,21,26,29-32H,5-7,10-11,14-20,22-23H2,1-2H3/t26?,29-,30+,31-,32+,35-/m0/s1 |
| InChIKey | RTTIGRPBCQETLZ-LVWWNWACSA-N |
| XLogP | 7.37 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|