C36H43NO4 — CID 91294844
[2-[(8S,13S,14S,17S)-13-methyl-3-oxo-11-(4-piperidin-1-ylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 91294844) has the molecular formula C36H43NO4 and a molecular weight of 553.74 g/mol. Its IUPAC name is [2-[(8S,13S,14S,17S)-13-methyl-3-oxo-11-(4-piperidin-1-ylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,13S,14S,17S)-13-methyl-3-oxo-11-(4-piperidin-1-ylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 91294844 |
| Molecular Formula | C36H43NO4 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | [2-[(8S,13S,14S,17S)-13-methyl-3-oxo-11-(4-piperidin-1-ylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC#C[C@]1(C(=O)COC(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3C(c3ccc(N4CCCCC4)cc3)C[C@@]21C |
| InChI | InChI=1S/C36H43NO4/c1-4-17-36(33(40)23-41-24(2)38)18-16-32-30-14-10-26-21-28(39)13-15-29(26)34(30)31(22-35(32,36)3)25-8-11-27(12-9-25)37-19-6-5-7-20-37/h8-9,11-12,21,30-32H,5-7,10,13-16,18-20,22-23H2,1-3H3/t30-,31?,32-,35-,36+/m0/s1 |
| InChIKey | ZFTICXKQMGMCEZ-DCMRZNLUSA-N |
| XLogP | 6.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|