C31H39NO3 — CID 70359025
(8S,11R,13S,14S,17R)-17-hydroxy-17-[(E)-3-hydroxyprop-1-enyl]-13-methyl-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70359025) has the molecular formula C31H39NO3 and a molecular weight of 473.66 g/mol. Its IUPAC name is (8S,11R,13S,14S,17R)-17-hydroxy-17-[(E)-3-hydroxyprop-1-enyl]-13-methyl-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17R)-17-hydroxy-17-[(E)-3-hydroxyprop-1-enyl]-13-methyl-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70359025 |
| Molecular Formula | C31H39NO3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | (8S,11R,13S,14S,17R)-17-hydroxy-17-[(E)-3-hydroxyprop-1-enyl]-13-methyl-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(N4CCCC4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)/C=C/CO |
| InChI | InChI=1S/C31H39NO3/c1-30-20-27(21-5-8-23(9-6-21)32-16-2-3-17-32)29-25-12-10-24(34)19-22(25)7-11-26(29)28(30)13-15-31(30,35)14-4-18-33/h4-6,8-9,14,19,26-28,33,35H,2-3,7,10-13,15-18,20H2,1H3/b14-4+/t26-,27+,28-,30-,31-/m0/s1 |
| InChIKey | ZCXNPQGFSOTLPL-MAQMUTATSA-N |
| XLogP | 5.47 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|