C28H33NO4 — CID 88635943
N-[4-[(8S,11R,13S,14S,17R)-17-hydroxy-17-[(Z)-3-hydroxyprop-1-enyl]-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]formamide (PubChem CID 88635943) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[4-[(8S,11R,13S,14S,17R)-17-hydroxy-17-[(Z)-3-hydroxyprop-1-enyl]-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]formamide.
| Compound Name | N-[4-[(8S,11R,13S,14S,17R)-17-hydroxy-17-[(Z)-3-hydroxyprop-1-enyl]-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]formamide |
|---|---|
| PubChem CID | 88635943 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | N-[4-[(8S,11R,13S,14S,17R)-17-hydroxy-17-[(Z)-3-hydroxyprop-1-enyl]-13-methyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]formamide |
| SMILES | C[C@]12C[C@H](c3ccc(NC=O)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)/C=C\CO |
| InChI | InChI=1S/C28H33NO4/c1-27-16-24(18-3-6-20(7-4-18)29-17-31)26-22-10-8-21(32)15-19(22)5-9-23(26)25(27)11-13-28(27,33)12-2-14-30/h2-4,6-7,12,15,17,23-25,30,33H,5,8-11,13-14,16H2,1H3,(H,29,31)/b12-2-/t23-,24+,25-,27-,28-/m0/s1 |
| InChIKey | DQLBZNWFIJKOJW-FUGMNKHXSA-N |
| XLogP | 4.43 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|