C31H34O4 — CID 22849483
(8S,11R,13S,14S,17R)-11-[4-(furan-3-yl)phenyl]-17-hydroxy-17-[(E)-3-hydroxyprop-1-enyl]-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22849483) has the molecular formula C31H34O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is (8S,11R,13S,14S,17R)-11-[4-(furan-3-yl)phenyl]-17-hydroxy-17-[(E)-3-hydroxyprop-1-enyl]-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17R)-11-[4-(furan-3-yl)phenyl]-17-hydroxy-17-[(E)-3-hydroxyprop-1-enyl]-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22849483 |
| Molecular Formula | C31H34O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (8S,11R,13S,14S,17R)-11-[4-(furan-3-yl)phenyl]-17-hydroxy-17-[(E)-3-hydroxyprop-1-enyl]-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(-c4ccoc4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)/C=C/CO |
| InChI | InChI=1S/C31H34O4/c1-30-18-27(21-5-3-20(4-6-21)23-12-16-35-19-23)29-25-10-8-24(33)17-22(25)7-9-26(29)28(30)11-14-31(30,34)13-2-15-32/h2-6,12-13,16-17,19,26-28,32,34H,7-11,14-15,18H2,1H3/b13-2+/t26-,27+,28-,30-,31-/m0/s1 |
| InChIKey | YJWCMTHODJHJJB-ZEBSSCOXSA-N |
| XLogP | 6.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|