C34H41NO2 — CID 20727974
(8S,11R,13S,14S,17S)-13-methyl-17-propanoyl-17-prop-1-ynyl-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 20727974) has the molecular formula C34H41NO2 and a molecular weight of 495.71 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-13-methyl-17-propanoyl-17-prop-1-ynyl-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-13-methyl-17-propanoyl-17-prop-1-ynyl-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 20727974 |
| Molecular Formula | C34H41NO2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.31 |
| IUPAC Name | (8S,11R,13S,14S,17S)-13-methyl-17-propanoyl-17-prop-1-ynyl-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(C(=O)CC)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N4CCCC4)cc3)C[C@@]21C |
| InChI | InChI=1S/C34H41NO2/c1-4-17-34(31(37)5-2)18-16-30-28-14-10-24-21-26(36)13-15-27(24)32(28)29(22-33(30,34)3)23-8-11-25(12-9-23)35-19-6-7-20-35/h8-9,11-12,21,28-30H,5-7,10,13-16,18-20,22H2,1-3H3/t28-,29+,30-,33-,34+/m0/s1 |
| InChIKey | ULBLGYVRLCQLNT-GAXVQCDJSA-N |
| XLogP | 7.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|