C32H39NO3 — CID 166881929
(8S,11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(morpholin-4-ylmethyl)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 166881929) has the molecular formula C32H39NO3 and a molecular weight of 485.67 g/mol. Its IUPAC name is (8S,11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(morpholin-4-ylmethyl)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(morpholin-4-ylmethyl)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 166881929 |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (8S,11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(morpholin-4-ylmethyl)phenyl]-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CCC2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(CN4CCOCC4)cc3)C[C@@]21C |
| InChI | InChI=1S/C32H39NO3/c1-3-13-32(35)14-12-29-27-10-8-24-19-25(34)9-11-26(24)30(27)28(20-31(29,32)2)23-6-4-22(5-7-23)21-33-15-17-36-18-16-33/h4-7,19,27-29,35H,8-12,14-18,20-21H2,1-2H3/t27-,28+,29?,31-,32-/m0/s1 |
| InChIKey | FJHQGGGGKOUODY-ITQQINFOSA-N |
| XLogP | 5.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|