C33H39F2NO3 — CID 129304754
(8S,11S,13S,14S,17S)-11-(2,6-difluoro-4-morpholin-4-ylphenyl)-17-hydroxy-13-methyl-17-(3-methylbut-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 129304754) has the molecular formula C33H39F2NO3 and a molecular weight of 535.68 g/mol. Its IUPAC name is (8S,11S,13S,14S,17S)-11-(2,6-difluoro-4-morpholin-4-ylphenyl)-17-hydroxy-13-methyl-17-(3-methylbut-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11S,13S,14S,17S)-11-(2,6-difluoro-4-morpholin-4-ylphenyl)-17-hydroxy-13-methyl-17-(3-methylbut-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 129304754 |
| Molecular Formula | C33H39F2NO3 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | (8S,11S,13S,14S,17S)-11-(2,6-difluoro-4-morpholin-4-ylphenyl)-17-hydroxy-13-methyl-17-(3-methylbut-1-ynyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3c(F)cc(N4CCOCC4)cc3F)C[C@@]21C |
| InChI | InChI=1S/C33H39F2NO3/c1-20(2)8-10-33(38)11-9-27-25-6-4-21-16-23(37)5-7-24(21)30(25)26(19-32(27,33)3)31-28(34)17-22(18-29(31)35)36-12-14-39-15-13-36/h16-18,20,25-27,38H,4-7,9,11-15,19H2,1-3H3/t25-,26-,27-,32-,33-/m0/s1 |
| InChIKey | IEIMCSPTIQTSTP-JCVZHIKZSA-N |
| XLogP | 6.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|