C35H41NO5 — CID 20728003
[2-[(8S,11R,13S,14S,17S)-13-methyl-11-(4-morpholin-4-ylphenyl)-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 20728003) has the molecular formula C35H41NO5 and a molecular weight of 555.72 g/mol. Its IUPAC name is [2-[(8S,11R,13S,14S,17S)-13-methyl-11-(4-morpholin-4-ylphenyl)-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,11R,13S,14S,17S)-13-methyl-11-(4-morpholin-4-ylphenyl)-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 20728003 |
| Molecular Formula | C35H41NO5 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | [2-[(8S,11R,13S,14S,17S)-13-methyl-11-(4-morpholin-4-ylphenyl)-3-oxo-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC#C[C@]1(C(=O)COC(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N4CCOCC4)cc3)C[C@@]21C |
| InChI | InChI=1S/C35H41NO5/c1-4-14-35(32(39)22-41-23(2)37)15-13-31-29-11-7-25-20-27(38)10-12-28(25)33(29)30(21-34(31,35)3)24-5-8-26(9-6-24)36-16-18-40-19-17-36/h5-6,8-9,20,29-31H,7,10-13,15-19,21-22H2,1-3H3/t29-,30+,31-,34-,35+/m0/s1 |
| InChIKey | VNLNTBFSZIKZEO-SESXGGOLSA-N |
| XLogP | 5.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|