C34H42N2O3 — CID 87605550
1-[(8S,11R,13S,14S,17S)-3-hydroxyimino-6,13-dimethyl-11-(4-morpholin-4-ylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 87605550) has the molecular formula C34H42N2O3 and a molecular weight of 526.72 g/mol. Its IUPAC name is 1-[(8S,11R,13S,14S,17S)-3-hydroxyimino-6,13-dimethyl-11-(4-morpholin-4-ylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8S,11R,13S,14S,17S)-3-hydroxyimino-6,13-dimethyl-11-(4-morpholin-4-ylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 87605550 |
| Molecular Formula | C34H42N2O3 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 1-[(8S,11R,13S,14S,17S)-3-hydroxyimino-6,13-dimethyl-11-(4-morpholin-4-ylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC#C[C@]1(C(C)=O)CC[C@H]2[C@@H]3CC(C)C4=CC(=NO)CCC4=C3[C@@H](c3ccc(N4CCOCC4)cc3)C[C@@]21C |
| InChI | InChI=1S/C34H42N2O3/c1-5-13-34(23(3)37)14-12-31-29-19-22(2)28-20-25(35-38)8-11-27(28)32(29)30(21-33(31,34)4)24-6-9-26(10-7-24)36-15-17-39-18-16-36/h6-7,9-10,20,22,29-31,38H,8,11-12,14-19,21H2,1-4H3/t22?,29-,30+,31-,33-,34+/m0/s1 |
| InChIKey | WPBDABGYRBGVAZ-QIZRVWSNSA-N |
| XLogP | 6.53 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|