C35H40FNO5 — CID 90950195
[2-[(8S,13S,14S,17S)-6-fluoro-17-(3-hydroxyprop-1-ynyl)-13-methyl-3-oxo-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 90950195) has the molecular formula C35H40FNO5 and a molecular weight of 573.71 g/mol. Its IUPAC name is [2-[(8S,13S,14S,17S)-6-fluoro-17-(3-hydroxyprop-1-ynyl)-13-methyl-3-oxo-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,13S,14S,17S)-6-fluoro-17-(3-hydroxyprop-1-ynyl)-13-methyl-3-oxo-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 90950195 |
| Molecular Formula | C35H40FNO5 |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | [2-[(8S,13S,14S,17S)-6-fluoro-17-(3-hydroxyprop-1-ynyl)-13-methyl-3-oxo-11-(4-pyrrolidin-1-ylphenyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(C#CCO)CC[C@H]2[C@@H]3CC(F)C4=CC(=O)CCC4=C3C(c3ccc(N4CCCC4)cc3)C[C@@]21C |
| InChI | InChI=1S/C35H40FNO5/c1-22(39)42-21-32(41)35(13-5-17-38)14-12-30-28-19-31(36)27-18-25(40)10-11-26(27)33(28)29(20-34(30,35)2)23-6-8-24(9-7-23)37-15-3-4-16-37/h6-9,18,28-31,38H,3-4,10-12,14-17,19-21H2,1-2H3/t28-,29?,30-,31?,34-,35+/m0/s1 |
| InChIKey | CLYGAVALGALXHN-PMBIPRMQSA-N |
| XLogP | 5.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|