C31H38ClNO2 — CID 123639855
(8S,13S,14S,17S)-17-(2-chloroacetyl)-13-methyl-2-(4-piperidin-1-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 123639855) has the molecular formula C31H38ClNO2 and a molecular weight of 492.10 g/mol. Its IUPAC name is (8S,13S,14S,17S)-17-(2-chloroacetyl)-13-methyl-2-(4-piperidin-1-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S,17S)-17-(2-chloroacetyl)-13-methyl-2-(4-piperidin-1-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123639855 |
| Molecular Formula | C31H38ClNO2 |
| Molecular Weight | 492.10 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | (8S,13S,14S,17S)-17-(2-chloroacetyl)-13-methyl-2-(4-piperidin-1-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC3=C4CC(c5ccc(N6CCCCC6)cc5)C(=O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2C(=O)CCl |
| InChI | InChI=1S/C31H38ClNO2/c1-31-14-13-23-24(27(31)11-12-28(31)30(35)19-32)10-7-21-17-29(34)26(18-25(21)23)20-5-8-22(9-6-20)33-15-3-2-4-16-33/h5-6,8-9,17,24,26-28H,2-4,7,10-16,18-19H2,1H3/t24-,26?,27+,28-,31+/m1/s1 |
| InChIKey | HPTFSVPQVWORJN-GPOORBSRSA-N |
| XLogP | 7.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.10 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|