C29H36O4 — CID 91134360
(8S,13S,14S,17S)-2-(4-acetylphenyl)-17-(2-methoxyethoxy)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 91134360) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is (8S,13S,14S,17S)-2-(4-acetylphenyl)-17-(2-methoxyethoxy)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S,17S)-2-(4-acetylphenyl)-17-(2-methoxyethoxy)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91134360 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (8S,13S,14S,17S)-2-(4-acetylphenyl)-17-(2-methoxyethoxy)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | COCCO[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C(c5ccc(C(C)=O)cc5)CC4=C3CC[C@]12C |
| InChI | InChI=1S/C29H36O4/c1-18(30)19-4-6-20(7-5-19)25-17-24-21(16-27(25)31)8-9-23-22(24)12-13-29(2)26(23)10-11-28(29)33-15-14-32-3/h4-7,16,23,25-26,28H,8-15,17H2,1-3H3/t23-,25?,26+,28+,29+/m1/s1 |
| InChIKey | RZOVGCZARJZSKK-JDSYKTTJSA-N |
| XLogP | 5.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|