C32H41NO3 — CID 176554429
5-[4-(17-acetyl-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)-N-methylanilino]pentanal (PubChem CID 176554429) has the molecular formula C32H41NO3 and a molecular weight of 487.68 g/mol. Its IUPAC name is 5-[4-(17-acetyl-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)-N-methylanilino]pentanal.
| Compound Name | 5-[4-(17-acetyl-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)-N-methylanilino]pentanal |
|---|---|
| PubChem CID | 176554429 |
| Molecular Formula | C32H41NO3 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 5-[4-(17-acetyl-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl)-N-methylanilino]pentanal |
| SMILES | CC(=O)C1CCC2C3CCC4=CC(=O)CCC4=C3C(c3ccc(N(C)CCCCC=O)cc3)CC12C |
| InChI | InChI=1S/C32H41NO3/c1-21(35)29-15-16-30-27-13-9-23-19-25(36)12-14-26(23)31(27)28(20-32(29,30)2)22-7-10-24(11-8-22)33(3)17-5-4-6-18-34/h7-8,10-11,18-19,27-30H,4-6,9,12-17,20H2,1-3H3 |
| InChIKey | WCVXGKGTCVLSKE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|