C35H47NO5 — CID 177251221
[(8S,11R,13S,14S,17R)-17-acetyl-11-[4-[6-hydroxyhexyl(methyl)amino]phenyl]-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 177251221) has the molecular formula C35H47NO5 and a molecular weight of 561.76 g/mol. Its IUPAC name is [(8S,11R,13S,14S,17R)-17-acetyl-11-[4-[6-hydroxyhexyl(methyl)amino]phenyl]-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(8S,11R,13S,14S,17R)-17-acetyl-11-[4-[6-hydroxyhexyl(methyl)amino]phenyl]-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 177251221 |
| Molecular Formula | C35H47NO5 |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.35 |
| IUPAC Name | [(8S,11R,13S,14S,17R)-17-acetyl-11-[4-[6-hydroxyhexyl(methyl)amino]phenyl]-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)OC1CC2=CC(=O)CCC2=C2[C@@H](c3ccc(N(C)CCCCCCO)cc3)C[C@]3(C)[C@H](C(C)=O)CC[C@H]3[C@@H]21 |
| InChI | InChI=1S/C35H47NO5/c1-22(38)30-15-16-31-34-32(41-23(2)39)20-25-19-27(40)13-14-28(25)33(34)29(21-35(30,31)3)24-9-11-26(12-10-24)36(4)17-7-5-6-8-18-37/h9-12,19,29-32,34,37H,5-8,13-18,20-21H2,1-4H3/t29-,30+,31+,32?,34-,35-/m1/s1 |
| InChIKey | VAODFCWBYYUHKI-ZZKQPUAASA-N |
| XLogP | 6.32 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|