C42H66BrNO2 — CID 176554675
1-bromobutane;11-[4-[7-hydroxyheptyl(methyl)amino]phenyl]-13-methyl-17-prop-1-en-2-yl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;propane (PubChem CID 176554675) has the molecular formula C42H66BrNO2 and a molecular weight of 696.90 g/mol. Its IUPAC name is 1-bromobutane;11-[4-[7-hydroxyheptyl(methyl)amino]phenyl]-13-methyl-17-prop-1-en-2-yl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;propane.
| Compound Name | 1-bromobutane;11-[4-[7-hydroxyheptyl(methyl)amino]phenyl]-13-methyl-17-prop-1-en-2-yl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;propane |
|---|---|
| PubChem CID | 176554675 |
| Molecular Formula | C42H66BrNO2 |
| Molecular Weight | 696.90 g/mol |
| Exact Mass | 695.43 |
| IUPAC Name | 1-bromobutane;11-[4-[7-hydroxyheptyl(methyl)amino]phenyl]-13-methyl-17-prop-1-en-2-yl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;propane |
| SMILES | C=C(C)C1CCC2C3CCC4=CC(=O)CCC4=C3C(c3ccc(N(C)CCCCCCCO)cc3)CC12C.CCC.CCCCBr |
| InChI | InChI=1S/C35H49NO2.C4H9Br.C3H8/c1-24(2)32-18-19-33-30-16-12-26-22-28(38)15-17-29(26)34(30)31(23-35(32,33)3)25-10-13-27(14-11-25)36(4)20-8-6-5-7-9-21-37;1-2-3-4-5;1-3-2/h10-11,13-14,22,30-33,37H,1,5-9,12,15-21,23H2,2-4H3;2-4H2,1H3;3H2,1-2H3 |
| InChIKey | BXCZMUQVKUWFBZ-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.90 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|