C30H35NO3 — CID 91134760
(8S,11R,13S,14S,17S)-17-acetyl-11-(4-aminophenyl)-6-(4-hydroxybut-2-ynyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 91134760) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-acetyl-11-(4-aminophenyl)-6-(4-hydroxybut-2-ynyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-acetyl-11-(4-aminophenyl)-6-(4-hydroxybut-2-ynyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 91134760 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-acetyl-11-(4-aminophenyl)-6-(4-hydroxybut-2-ynyl)-13-methyl-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC(CC#CCO)C4=CC(=O)CCC4=C3[C@@H](c3ccc(N)cc3)C[C@]12C |
| InChI | InChI=1S/C30H35NO3/c1-18(33)27-12-13-28-25-15-20(5-3-4-14-32)24-16-22(34)10-11-23(24)29(25)26(17-30(27,28)2)19-6-8-21(31)9-7-19/h6-9,16,20,25-28,32H,5,10-15,17,31H2,1-2H3/t20?,25-,26+,27+,28-,30+/m0/s1 |
| InChIKey | ZAHDZAIBCBRTEW-BIMLCAQOSA-N |
| XLogP | 4.99 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|