C26H34O3 — CID 165146160
13,17-dihydroxy-11-(4-methylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane (PubChem CID 165146160) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 13,17-dihydroxy-11-(4-methylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane.
| Compound Name | 13,17-dihydroxy-11-(4-methylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane |
|---|---|
| PubChem CID | 165146160 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 13,17-dihydroxy-11-(4-methylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one;ethane |
| SMILES | CC.Cc1ccc(C2CC3(O)C(O)CCC3C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C24H28O3.C2H6/c1-14-2-4-15(5-3-14)20-13-24(27)21(10-11-22(24)26)19-8-6-16-12-17(25)7-9-18(16)23(19)20;1-2/h2-5,12,19-22,26-27H,6-11,13H2,1H3;1-2H3 |
| InChIKey | TUGUYIDZUCUTAU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |