C32H35NO2 — CID 145095707
(11R,16R,17S)-17-acetyl-13,16-dimethyl-11-(4-pyridin-3-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 145095707) has the molecular formula C32H35NO2 and a molecular weight of 465.64 g/mol. Its IUPAC name is (11R,16R,17S)-17-acetyl-13,16-dimethyl-11-(4-pyridin-3-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,16R,17S)-17-acetyl-13,16-dimethyl-11-(4-pyridin-3-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 145095707 |
| Molecular Formula | C32H35NO2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (11R,16R,17S)-17-acetyl-13,16-dimethyl-11-(4-pyridin-3-ylphenyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1[C@H](C)CC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(-c4cccnc4)cc3)CC21C |
| InChI | InChI=1S/C32H35NO2/c1-19-15-29-27-12-10-23-16-25(35)11-13-26(23)30(27)28(17-32(29,3)31(19)20(2)34)22-8-6-21(7-9-22)24-5-4-14-33-18-24/h4-9,14,16,18-19,27-29,31H,10-13,15,17H2,1-3H3/t19-,27?,28-,29?,31-,32?/m1/s1 |
| InChIKey | COOIERVAWZUUKN-CTAJNGJHSA-N |
| XLogP | 7.10 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |